C31H36ClN3O4 — CID 21169593
4-butoxy-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 21169593) has the molecular formula C31H36ClN3O4 and a molecular weight of 550.10 g/mol. Its IUPAC name is 4-butoxy-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 4-butoxy-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 21169593 |
| Molecular Formula | C31H36ClN3O4 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 4-butoxy-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCN(C(=O)c4ccc(OCCC)cc4)CC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C31H36ClN3O4/c1-3-5-21-39-27-11-6-23(7-12-27)30(36)33-25-10-15-29(28(32)22-25)34-16-18-35(19-17-34)31(37)24-8-13-26(14-9-24)38-20-4-2/h6-15,22H,3-5,16-21H2,1-2H3,(H,33,36) |
| InChIKey | SWJQWLPAKYNUHH-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|