C32H36ClN3O3 — CID 21169351
(E)-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 21169351) has the molecular formula C32H36ClN3O3 and a molecular weight of 546.11 g/mol. Its IUPAC name is (E)-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21169351 |
| Molecular Formula | C32H36ClN3O3 |
| Molecular Weight | 546.11 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (E)-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(C(=O)N2CCN(c3ccc(NC(=O)/C=C/c4ccc(C(C)C)cc4)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C32H36ClN3O3/c1-4-21-39-28-13-10-26(11-14-28)32(38)36-19-17-35(18-20-36)30-15-12-27(22-29(30)33)34-31(37)16-7-24-5-8-25(9-6-24)23(2)3/h5-16,22-23H,4,17-21H2,1-3H3,(H,34,37)/b16-7+ |
| InChIKey | FCOREYPKURLJKN-FRKPEAEDSA-N |
| XLogP | 6.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.11 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|