C28H29Cl2N3O3S — CID 21170031
2-(4-chlorophenyl)sulfanyl-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 21170031) has the molecular formula C28H29Cl2N3O3S and a molecular weight of 558.53 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 21170031 |
| Molecular Formula | C28H29Cl2N3O3S |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[3-chloro-4-[4-(4-propoxybenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | CCCOc1ccc(C(=O)N2CCN(c3ccc(NC(=O)CSc4ccc(Cl)cc4)cc3Cl)CC2)cc1 |
| InChI | InChI=1S/C28H29Cl2N3O3S/c1-2-17-36-23-8-3-20(4-9-23)28(35)33-15-13-32(14-16-33)26-12-7-22(18-25(26)30)31-27(34)19-37-24-10-5-21(29)6-11-24/h3-12,18H,2,13-17,19H2,1H3,(H,31,34) |
| InChIKey | KMFZKYWRAUKTOB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|