C26H34ClN3O3 — CID 17358488
4-butoxy-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17358488) has the molecular formula C26H34ClN3O3 and a molecular weight of 472.03 g/mol. Its IUPAC name is 4-butoxy-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 4-butoxy-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17358488 |
| Molecular Formula | C26H34ClN3O3 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 4-butoxy-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(N3CCN(C(=O)C(C)(C)C)CC3)c(Cl)c2)cc1 |
| InChI | InChI=1S/C26H34ClN3O3/c1-5-6-17-33-21-10-7-19(8-11-21)24(31)28-20-9-12-23(22(27)18-20)29-13-15-30(16-14-29)25(32)26(2,3)4/h7-12,18H,5-6,13-17H2,1-4H3,(H,28,31) |
| InChIKey | DMGVLOOPUDNIFM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|