C22H25BrClN3O2 — CID 17050282
3-bromo-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17050282) has the molecular formula C22H25BrClN3O2 and a molecular weight of 478.82 g/mol. Its IUPAC name is 3-bromo-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 3-bromo-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17050282 |
| Molecular Formula | C22H25BrClN3O2 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 3-bromo-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CC(C)(C)C(=O)N1CCN(c2ccc(NC(=O)c3cccc(Br)c3)cc2Cl)CC1 |
| InChI | InChI=1S/C22H25BrClN3O2/c1-22(2,3)21(29)27-11-9-26(10-12-27)19-8-7-17(14-18(19)24)25-20(28)15-5-4-6-16(23)13-15/h4-8,13-14H,9-12H2,1-3H3,(H,25,28) |
| InChIKey | QOXVDBCFXKNSHH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|