C22H24Cl3N3O2 — CID 17050207
2,5-dichloro-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide (PubChem CID 17050207) has the molecular formula C22H24Cl3N3O2 and a molecular weight of 468.81 g/mol. Its IUPAC name is 2,5-dichloro-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 17050207 |
| Molecular Formula | C22H24Cl3N3O2 |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | 2,5-dichloro-N-[3-chloro-4-[4-(2,2-dimethylpropanoyl)piperazin-1-yl]phenyl]benzamide |
| SMILES | CC(C)(C)C(=O)N1CCN(c2ccc(NC(=O)c3cc(Cl)ccc3Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C22H24Cl3N3O2/c1-22(2,3)21(30)28-10-8-27(9-11-28)19-7-5-15(13-18(19)25)26-20(29)16-12-14(23)4-6-17(16)24/h4-7,12-13H,8-11H2,1-3H3,(H,26,29) |
| InChIKey | KETCBGYBDHXIJI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|