C22H23Cl3N4O2S — CID 17116064
N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2,5-dichlorobenzamide (PubChem CID 17116064) has the molecular formula C22H23Cl3N4O2S and a molecular weight of 513.88 g/mol. Its IUPAC name is N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2,5-dichlorobenzamide.
| Compound Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 17116064 |
| Molecular Formula | C22H23Cl3N4O2S |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-2,5-dichlorobenzamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cc(Cl)ccc3Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C22H23Cl3N4O2S/c1-2-3-20(30)29-10-8-28(9-11-29)19-7-5-15(13-18(19)25)26-22(32)27-21(31)16-12-14(23)4-6-17(16)24/h4-7,12-13H,2-3,8-11H2,1H3,(H2,26,27,31,32) |
| InChIKey | VTPDVHLBIJPFKQ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|