C19H27ClN4O2S — CID 22775746
N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]butanamide (PubChem CID 22775746) has the molecular formula C19H27ClN4O2S and a molecular weight of 410.97 g/mol. Its IUPAC name is N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]butanamide.
| Compound Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 22775746 |
| Molecular Formula | C19H27ClN4O2S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]butanamide |
| SMILES | CCCC(=O)NC(=S)Nc1ccc(N2CCN(C(=O)CCC)CC2)c(Cl)c1 |
| InChI | InChI=1S/C19H27ClN4O2S/c1-3-5-17(25)22-19(27)21-14-7-8-16(15(20)13-14)23-9-11-24(12-10-23)18(26)6-4-2/h7-8,13H,3-6,9-12H2,1-2H3,(H2,21,22,25,27) |
| InChIKey | VDSQMUPEHJKMDV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|