C20H23ClN4O2S2 — CID 2944003
N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 2944003) has the molecular formula C20H23ClN4O2S2 and a molecular weight of 451.02 g/mol. Its IUPAC name is N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2944003 |
| Molecular Formula | C20H23ClN4O2S2 |
| Molecular Weight | 451.02 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)c3cccs3)cc2Cl)CC1 |
| InChI | InChI=1S/C20H23ClN4O2S2/c1-2-4-18(26)25-10-8-24(9-11-25)16-7-6-14(13-15(16)21)22-20(28)23-19(27)17-5-3-12-29-17/h3,5-7,12-13H,2,4,8-11H2,1H3,(H2,22,23,27,28) |
| InChIKey | CNONRCPNLMIXAV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.02 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|