C20H29ClN4O2S — CID 22778247
N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-methylbutanamide (PubChem CID 22778247) has the molecular formula C20H29ClN4O2S and a molecular weight of 425.00 g/mol. Its IUPAC name is N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 22778247 |
| Molecular Formula | C20H29ClN4O2S |
| Molecular Weight | 425.00 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-[[4-(4-butanoylpiperazin-1-yl)-3-chlorophenyl]carbamothioyl]-3-methylbutanamide |
| SMILES | CCCC(=O)N1CCN(c2ccc(NC(=S)NC(=O)CC(C)C)cc2Cl)CC1 |
| InChI | InChI=1S/C20H29ClN4O2S/c1-4-5-19(27)25-10-8-24(9-11-25)17-7-6-15(13-16(17)21)22-20(28)23-18(26)12-14(2)3/h6-7,13-14H,4-5,8-12H2,1-3H3,(H2,22,23,26,28) |
| InChIKey | HKLVRCAUCWKXBW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.00 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|