C22H22ClF5N4OS — CID 3794822
N-[[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-3-methylbutanamide (PubChem CID 3794822) has the molecular formula C22H22ClF5N4OS and a molecular weight of 520.96 g/mol. Its IUPAC name is N-[[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-3-methylbutanamide.
| Compound Name | N-[[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 3794822 |
| Molecular Formula | C22H22ClF5N4OS |
| Molecular Weight | 520.96 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | N-[[3-chloro-4-[4-(2,3,4,5,6-pentafluorophenyl)piperazin-1-yl]phenyl]carbamothioyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(=S)Nc1ccc(N2CCN(c3c(F)c(F)c(F)c(F)c3F)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H22ClF5N4OS/c1-11(2)9-15(33)30-22(34)29-12-3-4-14(13(23)10-12)31-5-7-32(8-6-31)21-19(27)17(25)16(24)18(26)20(21)28/h3-4,10-11H,5-9H2,1-2H3,(H2,29,30,33,34) |
| InChIKey | AMDQVOVBXFLPRB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.96 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|