C19H19ClFN3O2S — CID 26167306
N-(3-chloro-4-fluorophenyl)-3-(3-methylbutanoylcarbamothioylamino)benzamide (PubChem CID 26167306) has the molecular formula C19H19ClFN3O2S and a molecular weight of 407.90 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(3-methylbutanoylcarbamothioylamino)benzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(3-methylbutanoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 26167306 |
| Molecular Formula | C19H19ClFN3O2S |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(3-methylbutanoylcarbamothioylamino)benzamide |
| SMILES | CC(C)CC(=O)NC(=S)Nc1cccc(C(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H19ClFN3O2S/c1-11(2)8-17(25)24-19(27)23-13-5-3-4-12(9-13)18(26)22-14-6-7-16(21)15(20)10-14/h3-7,9-11H,8H2,1-2H3,(H,22,26)(H2,23,24,25,27) |
| InChIKey | WRFTXLPUEWHRAT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|