C32H26Cl2F2N4O4 — CID 43878146
N,N'-bis[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]hexanediamide (PubChem CID 43878146) has the molecular formula C32H26Cl2F2N4O4 and a molecular weight of 639.49 g/mol. Its IUPAC name is N,N'-bis[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]hexanediamide.
| Compound Name | N,N'-bis[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 43878146 |
| Molecular Formula | C32H26Cl2F2N4O4 |
| Molecular Weight | 639.49 g/mol |
| Exact Mass | 638.13 |
| IUPAC Name | N,N'-bis[3-[(3-chloro-4-fluorophenyl)carbamoyl]phenyl]hexanediamide |
| SMILES | O=C(CCCCC(=O)Nc1cccc(C(=O)Nc2ccc(F)c(Cl)c2)c1)Nc1cccc(C(=O)Nc2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C32H26Cl2F2N4O4/c33-25-17-23(11-13-27(25)35)39-31(43)19-5-3-7-21(15-19)37-29(41)9-1-2-10-30(42)38-22-8-4-6-20(16-22)32(44)40-24-12-14-28(36)26(34)18-24/h3-8,11-18H,1-2,9-10H2,(H,37,41)(H,38,42)(H,39,43)(H,40,44) |
| InChIKey | OYCNPOKNOYFOGP-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.49 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|