C19H20FN3O3 — CID 86817394
N'-[3-[(3-fluorophenyl)carbamoyl]phenyl]hexanediamide (PubChem CID 86817394) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is N'-[3-[(3-fluorophenyl)carbamoyl]phenyl]hexanediamide.
| Compound Name | N'-[3-[(3-fluorophenyl)carbamoyl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 86817394 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N'-[3-[(3-fluorophenyl)carbamoyl]phenyl]hexanediamide |
| SMILES | NC(=O)CCCCC(=O)Nc1cccc(C(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H20FN3O3/c20-14-6-4-8-16(12-14)23-19(26)13-5-3-7-15(11-13)22-18(25)10-2-1-9-17(21)24/h3-8,11-12H,1-2,9-10H2,(H2,21,24)(H,22,25)(H,23,26) |
| InChIKey | SLKGQPMJXXKTKJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|