C18H18F2N2O2S2 — CID 44817242
3-[[3-(3-fluoroanilino)-3-oxopropyl]disulfanyl]-N-(3-fluorophenyl)propanamide (PubChem CID 44817242) has the molecular formula C18H18F2N2O2S2 and a molecular weight of 396.48 g/mol. Its IUPAC name is 3-[[3-(3-fluoroanilino)-3-oxopropyl]disulfanyl]-N-(3-fluorophenyl)propanamide.
| Compound Name | 3-[[3-(3-fluoroanilino)-3-oxopropyl]disulfanyl]-N-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 44817242 |
| Molecular Formula | C18H18F2N2O2S2 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-[[3-(3-fluoroanilino)-3-oxopropyl]disulfanyl]-N-(3-fluorophenyl)propanamide |
| SMILES | O=C(CCSSCCC(=O)Nc1cccc(F)c1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C18H18F2N2O2S2/c19-13-3-1-5-15(11-13)21-17(23)7-9-25-26-10-8-18(24)22-16-6-2-4-14(20)12-16/h1-6,11-12H,7-10H2,(H,21,23)(H,22,24) |
| InChIKey | IKYWYRYIRKYEPY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|