C13H18BNO5S2 — CID 102520008
[3-[3-[(3-methoxy-3-oxopropyl)disulfanyl]propanoylamino]phenyl]boronic acid (PubChem CID 102520008) has the molecular formula C13H18BNO5S2 and a molecular weight of 343.24 g/mol. Its IUPAC name is [3-[3-[(3-methoxy-3-oxopropyl)disulfanyl]propanoylamino]phenyl]boronic acid.
| Compound Name | [3-[3-[(3-methoxy-3-oxopropyl)disulfanyl]propanoylamino]phenyl]boronic acid |
|---|---|
| PubChem CID | 102520008 |
| Molecular Formula | C13H18BNO5S2 |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | [3-[3-[(3-methoxy-3-oxopropyl)disulfanyl]propanoylamino]phenyl]boronic acid |
| SMILES | COC(=O)CCSSCCC(=O)Nc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C13H18BNO5S2/c1-20-13(17)6-8-22-21-7-5-12(16)15-11-4-2-3-10(9-11)14(18)19/h2-4,9,18-19H,5-8H2,1H3,(H,15,16) |
| InChIKey | FLOHOMUMFGLPAK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|