C15H18N2O3S — CID 43617799
methyl 3-[4-(3-cyanoanilino)-4-oxobutyl]sulfanylpropanoate (PubChem CID 43617799) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is methyl 3-[4-(3-cyanoanilino)-4-oxobutyl]sulfanylpropanoate.
| Compound Name | methyl 3-[4-(3-cyanoanilino)-4-oxobutyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 43617799 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | methyl 3-[4-(3-cyanoanilino)-4-oxobutyl]sulfanylpropanoate |
| SMILES | COC(=O)CCSCCCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H18N2O3S/c1-20-15(19)7-9-21-8-3-6-14(18)17-13-5-2-4-12(10-13)11-16/h2,4-5,10H,3,6-9H2,1H3,(H,17,18) |
| InChIKey | BWLKXJXDRKRFIU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|