C15H20N2O3S — CID 64690023
N-(3-cyanophenyl)-4-(3-methoxypropylsulfinyl)butanamide (PubChem CID 64690023) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-(3-methoxypropylsulfinyl)butanamide.
| Compound Name | N-(3-cyanophenyl)-4-(3-methoxypropylsulfinyl)butanamide |
|---|---|
| PubChem CID | 64690023 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(3-cyanophenyl)-4-(3-methoxypropylsulfinyl)butanamide |
| SMILES | COCCCS(=O)CCCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-20-8-4-10-21(19)9-3-7-15(18)17-14-6-2-5-13(11-14)12-16/h2,5-6,11H,3-4,7-10H2,1H3,(H,17,18) |
| InChIKey | QETUMYNEFDWGEQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|