C15H20N2OS — CID 43615804
4-butylsulfanyl-N-(3-cyanophenyl)butanamide (PubChem CID 43615804) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-butylsulfanyl-N-(3-cyanophenyl)butanamide.
| Compound Name | 4-butylsulfanyl-N-(3-cyanophenyl)butanamide |
|---|---|
| PubChem CID | 43615804 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-butylsulfanyl-N-(3-cyanophenyl)butanamide |
| SMILES | CCCCSCCCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H20N2OS/c1-2-3-9-19-10-5-8-15(18)17-14-7-4-6-13(11-14)12-16/h4,6-7,11H,2-3,5,8-10H2,1H3,(H,17,18) |
| InChIKey | FAWPMZNBJLBBCR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|