C19H20N2O3 — CID 110428452
N-(3-cyanophenyl)-4-(3,4-dimethoxyphenyl)butanamide (PubChem CID 110428452) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-(3,4-dimethoxyphenyl)butanamide.
| Compound Name | N-(3-cyanophenyl)-4-(3,4-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 110428452 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-(3-cyanophenyl)-4-(3,4-dimethoxyphenyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)Nc2cccc(C#N)c2)cc1OC |
| InChI | InChI=1S/C19H20N2O3/c1-23-17-10-9-14(12-18(17)24-2)5-4-8-19(22)21-16-7-3-6-15(11-16)13-20/h3,6-7,9-12H,4-5,8H2,1-2H3,(H,21,22) |
| InChIKey | IEOAKWLLIOSXJJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |