C22H28N2O4 — CID 110612957
4-(3,4-dimethoxyphenyl)-N-(3-morpholin-4-ylphenyl)butanamide (PubChem CID 110612957) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-N-(3-morpholin-4-ylphenyl)butanamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-N-(3-morpholin-4-ylphenyl)butanamide |
|---|---|
| PubChem CID | 110612957 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-N-(3-morpholin-4-ylphenyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)Nc2cccc(N3CCOCC3)c2)cc1OC |
| InChI | InChI=1S/C22H28N2O4/c1-26-20-10-9-17(15-21(20)27-2)5-3-8-22(25)23-18-6-4-7-19(16-18)24-11-13-28-14-12-24/h4,6-7,9-10,15-16H,3,5,8,11-14H2,1-2H3,(H,23,25) |
| InChIKey | FJWOAUNRRPAWIX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |