C19H21N3O4 — CID 109042534
N-(3-cyanophenyl)-3-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 109042534) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is N-(3-cyanophenyl)-3-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-(3-cyanophenyl)-3-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 109042534 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-(3-cyanophenyl)-3-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NCCC(=O)Nc2cccc(C#N)c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21N3O4/c1-24-16-10-15(11-17(25-2)19(16)26-3)21-8-7-18(23)22-14-6-4-5-13(9-14)12-20/h4-6,9-11,21H,7-8H2,1-3H3,(H,22,23) |
| InChIKey | YCZTVSNQEUWWIJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|