C18H19N3O3 — CID 109040577
3-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)propanamide (PubChem CID 109040577) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | 3-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 109040577 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCNc2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C18H19N3O3/c1-23-16-8-7-15(11-17(16)24-2)21-18(22)9-10-20-14-5-3-13(12-19)4-6-14/h3-8,11,20H,9-10H2,1-2H3,(H,21,22) |
| InChIKey | BAOUFBHRYXVPAG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |