C17H17N3O3 — CID 26437501
2-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)acetamide (PubChem CID 26437501) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | 2-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 26437501 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-(4-cyanoanilino)-N-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CNc2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C17H17N3O3/c1-22-15-8-7-14(9-16(15)23-2)20-17(21)11-19-13-5-3-12(10-18)4-6-13/h3-9,19H,11H2,1-2H3,(H,20,21) |
| InChIKey | KTDHZPABAYZLJP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |