C16H16F2N2O3 — CID 109009628
N-(3,4-difluorophenyl)-2-(3,4-dimethoxyanilino)acetamide (PubChem CID 109009628) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(3,4-dimethoxyanilino)acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(3,4-dimethoxyanilino)acetamide |
|---|---|
| PubChem CID | 109009628 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(3,4-dimethoxyanilino)acetamide |
| SMILES | COc1ccc(NCC(=O)Nc2ccc(F)c(F)c2)cc1OC |
| InChI | InChI=1S/C16H16F2N2O3/c1-22-14-6-4-10(8-15(14)23-2)19-9-16(21)20-11-3-5-12(17)13(18)7-11/h3-8,19H,9H2,1-2H3,(H,20,21) |
| InChIKey | VGLXUZDMVHRUDM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|