C14H11ClF2N2O — CID 9098972
2-(4-chloroanilino)-N-(3,4-difluorophenyl)acetamide (PubChem CID 9098972) has the molecular formula C14H11ClF2N2O and a molecular weight of 296.70 g/mol. Its IUPAC name is 2-(4-chloroanilino)-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-(4-chloroanilino)-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 9098972 |
| Molecular Formula | C14H11ClF2N2O |
| Molecular Weight | 296.70 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 2-(4-chloroanilino)-N-(3,4-difluorophenyl)acetamide |
| SMILES | O=C(CNc1ccc(Cl)cc1)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11ClF2N2O/c15-9-1-3-10(4-2-9)18-8-14(20)19-11-5-6-12(16)13(17)7-11/h1-7,18H,8H2,(H,19,20) |
| InChIKey | KQNQYUKEGBZJKK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.70 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |