C15H13ClF2N2O — CID 9102939
2-(5-chloro-2-methylanilino)-N-(3,4-difluorophenyl)acetamide (PubChem CID 9102939) has the molecular formula C15H13ClF2N2O and a molecular weight of 310.73 g/mol. Its IUPAC name is 2-(5-chloro-2-methylanilino)-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-(5-chloro-2-methylanilino)-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 9102939 |
| Molecular Formula | C15H13ClF2N2O |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 2-(5-chloro-2-methylanilino)-N-(3,4-difluorophenyl)acetamide |
| SMILES | Cc1ccc(Cl)cc1NCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H13ClF2N2O/c1-9-2-3-10(16)6-14(9)19-8-15(21)20-11-4-5-12(17)13(18)7-11/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | HRRCXBNXYQGAGH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |