C16H15ClF2N2O2 — CID 109011257
N-(4-chloro-2-methoxy-5-methylphenyl)-2-(3,4-difluoroanilino)acetamide (PubChem CID 109011257) has the molecular formula C16H15ClF2N2O2 and a molecular weight of 340.76 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2-(3,4-difluoroanilino)acetamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-(3,4-difluoroanilino)acetamide |
|---|---|
| PubChem CID | 109011257 |
| Molecular Formula | C16H15ClF2N2O2 |
| Molecular Weight | 340.76 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-(3,4-difluoroanilino)acetamide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)CNc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H15ClF2N2O2/c1-9-5-14(15(23-2)7-11(9)17)21-16(22)8-20-10-3-4-12(18)13(19)6-10/h3-7,20H,8H2,1-2H3,(H,21,22) |
| InChIKey | JNYUQJIQBFRIBV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |