C19H23ClN2O4 — CID 87029713
N-(4-chloro-2-methoxy-5-methylphenyl)-2-[3-(2-methoxyethoxy)anilino]acetamide (PubChem CID 87029713) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-2-[3-(2-methoxyethoxy)anilino]acetamide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-[3-(2-methoxyethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 87029713 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-2-[3-(2-methoxyethoxy)anilino]acetamide |
| SMILES | COCCOc1cccc(NCC(=O)Nc2cc(C)c(Cl)cc2OC)c1 |
| InChI | InChI=1S/C19H23ClN2O4/c1-13-9-17(18(25-3)11-16(13)20)22-19(23)12-21-14-5-4-6-15(10-14)26-8-7-24-2/h4-6,9-11,21H,7-8,12H2,1-3H3,(H,22,23) |
| InChIKey | ZYXCLEITOGIGLB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|