C20H23N3O — CID 109037144
N-(3-cyanophenyl)-3-(2,6-diethylanilino)propanamide (PubChem CID 109037144) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is N-(3-cyanophenyl)-3-(2,6-diethylanilino)propanamide.
| Compound Name | N-(3-cyanophenyl)-3-(2,6-diethylanilino)propanamide |
|---|---|
| PubChem CID | 109037144 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-(3-cyanophenyl)-3-(2,6-diethylanilino)propanamide |
| SMILES | CCc1cccc(CC)c1NCCC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H23N3O/c1-3-16-8-6-9-17(4-2)20(16)22-12-11-19(24)23-18-10-5-7-15(13-18)14-21/h5-10,13,22H,3-4,11-12H2,1-2H3,(H,23,24) |
| InChIKey | GJGOUZBFEYAKBX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |