C16H13F2N3O — CID 109042830
3-(3-cyanoanilino)-N-(2,6-difluorophenyl)propanamide (PubChem CID 109042830) has the molecular formula C16H13F2N3O and a molecular weight of 301.30 g/mol. Its IUPAC name is 3-(3-cyanoanilino)-N-(2,6-difluorophenyl)propanamide.
| Compound Name | 3-(3-cyanoanilino)-N-(2,6-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 109042830 |
| Molecular Formula | C16H13F2N3O |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-(3-cyanoanilino)-N-(2,6-difluorophenyl)propanamide |
| SMILES | N#Cc1cccc(NCCC(=O)Nc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C16H13F2N3O/c17-13-5-2-6-14(18)16(13)21-15(22)7-8-20-12-4-1-3-11(9-12)10-19/h1-6,9,20H,7-8H2,(H,21,22) |
| InChIKey | YZUFMDDKSRLVNQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |