C22H25N3O2 — CID 108968587
N-(3-cyanophenyl)-N'-(2,6-diethylphenyl)-2,2-dimethylpropanediamide (PubChem CID 108968587) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N'-(2,6-diethylphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(3-cyanophenyl)-N'-(2,6-diethylphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108968587 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-(3-cyanophenyl)-N'-(2,6-diethylphenyl)-2,2-dimethylpropanediamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(C)(C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-5-16-10-8-11-17(6-2)19(16)25-21(27)22(3,4)20(26)24-18-12-7-9-15(13-18)14-23/h7-13H,5-6H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | BEFYWTITKIHPDZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|