C19H19N3O3 — CID 108969395
N-(3-cyanophenyl)-N'-(3-methoxyphenyl)-2,2-dimethylpropanediamide (PubChem CID 108969395) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N'-(3-methoxyphenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(3-cyanophenyl)-N'-(3-methoxyphenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108969395 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | N-(3-cyanophenyl)-N'-(3-methoxyphenyl)-2,2-dimethylpropanediamide |
| SMILES | COc1cccc(NC(=O)C(C)(C)C(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C19H19N3O3/c1-19(2,17(23)21-14-7-4-6-13(10-14)12-20)18(24)22-15-8-5-9-16(11-15)25-3/h4-11H,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | YVGSYGIZJSHMLW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|