C16H21N3O2 — CID 108965790
N-(3-cyanophenyl)-N',N'-diethyl-2,2-dimethylpropanediamide (PubChem CID 108965790) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N',N'-diethyl-2,2-dimethylpropanediamide.
| Compound Name | N-(3-cyanophenyl)-N',N'-diethyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965790 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-(3-cyanophenyl)-N',N'-diethyl-2,2-dimethylpropanediamide |
| SMILES | CCN(CC)C(=O)C(C)(C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-5-19(6-2)15(21)16(3,4)14(20)18-13-9-7-8-12(10-13)11-17/h7-10H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | TZONWGITYPNPQE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|