C20H20ClN3O2 — CID 108966987
N-[2-(3-chlorophenyl)ethyl]-N'-(3-cyanophenyl)-2,2-dimethylpropanediamide (PubChem CID 108966987) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N'-(3-cyanophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N'-(3-cyanophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108966987 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N'-(3-cyanophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NCCc1cccc(Cl)c1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H20ClN3O2/c1-20(2,19(26)24-17-8-4-6-15(12-17)13-22)18(25)23-10-9-14-5-3-7-16(21)11-14/h3-8,11-12H,9-10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | BJTAFQCXJNYVHW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|