C17H25ClN2O3 — CID 108959695
N-[2-(3-chlorophenyl)ethyl]-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide (PubChem CID 108959695) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108959695 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N'-(3-methoxypropyl)-2,2-dimethylpropanediamide |
| SMILES | COCCCNC(=O)C(C)(C)C(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H25ClN2O3/c1-17(2,15(21)19-9-5-11-23-3)16(22)20-10-8-13-6-4-7-14(18)12-13/h4,6-7,12H,5,8-11H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | CHGXBLRDRJVNEV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|