C10H12ClNO2 — CID 897069
methyl N-[2-(3-chlorophenyl)ethyl]carbamate (PubChem CID 897069) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is methyl N-[2-(3-chlorophenyl)ethyl]carbamate.
| Compound Name | methyl N-[2-(3-chlorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 897069 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | methyl N-[2-(3-chlorophenyl)ethyl]carbamate |
| SMILES | COC(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H12ClNO2/c1-14-10(13)12-6-5-8-3-2-4-9(11)7-8/h2-4,7H,5-6H2,1H3,(H,12,13) |
| InChIKey | UUYWCADMDYCGSA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |