C20H22Cl2N2O2 — CID 2166305
N,N'-bis[2-(3-chlorophenyl)ethyl]butanediamide (PubChem CID 2166305) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is N,N'-bis[2-(3-chlorophenyl)ethyl]butanediamide.
| Compound Name | N,N'-bis[2-(3-chlorophenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 2166305 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N,N'-bis[2-(3-chlorophenyl)ethyl]butanediamide |
| SMILES | O=C(CCC(=O)NCCc1cccc(Cl)c1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c21-17-5-1-3-15(13-17)9-11-23-19(25)7-8-20(26)24-12-10-16-4-2-6-18(22)14-16/h1-6,13-14H,7-12H2,(H,23,25)(H,24,26) |
| InChIKey | CONQKTLPCSJGGH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |