C19H20Cl2N2O2 — CID 27838626
4-chloro-N-[4-[2-(3-chlorophenyl)ethylamino]-4-oxobutyl]benzamide (PubChem CID 27838626) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 4-chloro-N-[4-[2-(3-chlorophenyl)ethylamino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[2-(3-chlorophenyl)ethylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 27838626 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 4-chloro-N-[4-[2-(3-chlorophenyl)ethylamino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(Cl)cc1)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-16-8-6-15(7-9-16)19(25)23-11-2-5-18(24)22-12-10-14-3-1-4-17(21)13-14/h1,3-4,6-9,13H,2,5,10-12H2,(H,22,24)(H,23,25) |
| InChIKey | OPXPTQUUJSQVMC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|