C19H20Cl2N2O2 — CID 46650943
N-[4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutyl]benzamide (PubChem CID 46650943) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N-[4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 46650943 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-16-9-8-14(17(21)13-16)10-12-22-18(24)7-4-11-23-19(25)15-5-2-1-3-6-15/h1-3,5-6,8-9,13H,4,7,10-12H2,(H,22,24)(H,23,25) |
| InChIKey | IQVJMSOAUBANLG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|