C14H12Cl2N2O — CID 17472910
N-[2-(2,4-dichlorophenyl)ethyl]pyridine-3-carboxamide (PubChem CID 17472910) has the molecular formula C14H12Cl2N2O and a molecular weight of 295.17 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 17472910 |
| Molecular Formula | C14H12Cl2N2O |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)c1cccnc1 |
| InChI | InChI=1S/C14H12Cl2N2O/c15-12-4-3-10(13(16)8-12)5-7-18-14(19)11-2-1-6-17-9-11/h1-4,6,8-9H,5,7H2,(H,18,19) |
| InChIKey | HDLXYJHGMZNPGE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |