C17H16Cl2N2O2 — CID 110416767
N-[2-(2,4-dichlorophenyl)ethyl]-4-oxo-4-pyridin-3-ylbutanamide (PubChem CID 110416767) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-oxo-4-pyridin-3-ylbutanamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-oxo-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110416767 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-oxo-4-pyridin-3-ylbutanamide |
| SMILES | O=C(CCC(=O)c1cccnc1)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N2O2/c18-14-4-3-12(15(19)10-14)7-9-21-17(23)6-5-16(22)13-2-1-8-20-11-13/h1-4,8,10-11H,5-7,9H2,(H,21,23) |
| InChIKey | XAAABYCAAHPEJE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |