C12H13Cl2NO3 — CID 9151806
4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid (PubChem CID 9151806) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 9151806 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO3/c13-9-2-1-8(10(14)7-9)5-6-15-11(16)3-4-12(17)18/h1-2,7H,3-6H2,(H,15,16)(H,17,18) |
| InChIKey | PSTMCSCWYPTVPX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |