4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid

C12H13Cl2NO3 — CID 9151806

IUPAC4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)NCCc1ccc(Cl)cc1Cl
InChIInChI=1S/C12H13Cl2NO3/c13-9-2-1-8(10(14)7-9)5-6-15-11(16)3-4-12(17)18/h1-2,7H,3-6H2,(H,15,16)(H,17,18)
InChIKeyPSTMCSCWYPTVPX-UHFFFAOYSA-N
MW290.15 g/mol
LogP2.52
Rot. Bonds6

About 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid

4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid (PubChem CID 9151806) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid.

Molecular Properties

Compound Name4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid
PubChem CID9151806
Molecular FormulaC12H13Cl2NO3
Molecular Weight290.15 g/mol
Exact Mass289.03
IUPAC Name4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid
SMILESO=C(O)CCC(=O)NCCc1ccc(Cl)cc1Cl
InChIInChI=1S/C12H13Cl2NO3/c13-9-2-1-8(10(14)7-9)5-6-15-11(16)3-4-12(17)18/h1-2,7H,3-6H2,(H,15,16)(H,17,18)
InChIKeyPSTMCSCWYPTVPX-UHFFFAOYSA-N
XLogP2.52
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.15
LogP ≤ 52.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid?
The IUPAC name of 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid (CID 9151806) is 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid.
What is the SMILES notation for 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid?
The canonical SMILES for 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid is O=C(O)CCC(=O)NCCc1ccc(Cl)cc1Cl.
What is the InChIKey of 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid?
The InChIKey is PSTMCSCWYPTVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Cl2NO3/c13-9-2-1-8(10(14)7-9)5-6-15-11(16)3-4-12(17)18/h1-2,7H,3-6H2,(H,15,16)(H,17,18).
What are the key properties of 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid?
4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid has a molecular weight of 290.15 g/mol, XLogP of 2.52, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,4-dichlorophenyl)ethylamino]-4-oxobutanoic acid is sourced from PubChem (CID 9151806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).