C14H20Cl2N2O — CID 82017216
5-amino-N-[2-(2,4-dichlorophenyl)ethyl]-4-methylpentanamide (PubChem CID 82017216) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 5-amino-N-[2-(2,4-dichlorophenyl)ethyl]-4-methylpentanamide.
| Compound Name | 5-amino-N-[2-(2,4-dichlorophenyl)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 82017216 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 5-amino-N-[2-(2,4-dichlorophenyl)ethyl]-4-methylpentanamide |
| SMILES | CC(CN)CCC(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O/c1-10(9-17)2-5-14(19)18-7-6-11-3-4-12(15)8-13(11)16/h3-4,8,10H,2,5-7,9,17H2,1H3,(H,18,19) |
| InChIKey | OZSAULCADOSEIL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |