C13H19Cl3N2O — CID 119263881
2-amino-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide;hydrochloride (PubChem CID 119263881) has the molecular formula C13H19Cl3N2O and a molecular weight of 325.67 g/mol. Its IUPAC name is 2-amino-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119263881 |
| Molecular Formula | C13H19Cl3N2O |
| Molecular Weight | 325.67 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 2-amino-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)NCCc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C13H18Cl2N2O.ClH/c1-2-3-12(16)13(18)17-7-6-9-4-5-10(14)8-11(9)15;/h4-5,8,12H,2-3,6-7,16H2,1H3,(H,17,18);1H |
| InChIKey | MDLVHXJSZIHBDL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |