C13H16BrCl2NO — CID 43095602
2-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-3-methylbutanamide (PubChem CID 43095602) has the molecular formula C13H16BrCl2NO and a molecular weight of 353.09 g/mol. Its IUPAC name is 2-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-3-methylbutanamide.
| Compound Name | 2-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 43095602 |
| Molecular Formula | C13H16BrCl2NO |
| Molecular Weight | 353.09 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 2-bromo-N-[2-(2,4-dichlorophenyl)ethyl]-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16BrCl2NO/c1-8(2)12(14)13(18)17-6-5-9-3-4-10(15)7-11(9)16/h3-4,7-8,12H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | AQAQYKSNMMHXTQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|