C12H15Cl2N3O2 — CID 60847585
2-amino-N-[2-(2,4-dichlorophenyl)ethyl]butanediamide (PubChem CID 60847585) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 2-amino-N-[2-(2,4-dichlorophenyl)ethyl]butanediamide.
| Compound Name | 2-amino-N-[2-(2,4-dichlorophenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 60847585 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 2-amino-N-[2-(2,4-dichlorophenyl)ethyl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H15Cl2N3O2/c13-8-2-1-7(9(14)5-8)3-4-17-12(19)10(15)6-11(16)18/h1-2,5,10H,3-4,6,15H2,(H2,16,18)(H,17,19) |
| InChIKey | PUVMIPVHMPOJCC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |