C12H16ClN3O2 — CID 83340796
(2R)-2-amino-N-[2-(4-chlorophenyl)ethyl]butanediamide (PubChem CID 83340796) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-(4-chlorophenyl)ethyl]butanediamide.
| Compound Name | (2R)-2-amino-N-[2-(4-chlorophenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 83340796 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (2R)-2-amino-N-[2-(4-chlorophenyl)ethyl]butanediamide |
| SMILES | NC(=O)C[C@@H](N)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClN3O2/c13-9-3-1-8(2-4-9)5-6-16-12(18)10(14)7-11(15)17/h1-4,10H,5-7,14H2,(H2,15,17)(H,16,18)/t10-/m1/s1 |
| InChIKey | CGOBIGORGLGQEK-SNVBAGLBSA-N |
| XLogP | 0.20 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |