C12H15BrClNO — CID 92864169
(2R)-2-bromo-N-[2-(4-chlorophenyl)ethyl]butanamide (PubChem CID 92864169) has the molecular formula C12H15BrClNO and a molecular weight of 304.62 g/mol. Its IUPAC name is (2R)-2-bromo-N-[2-(4-chlorophenyl)ethyl]butanamide.
| Compound Name | (2R)-2-bromo-N-[2-(4-chlorophenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 92864169 |
| Molecular Formula | C12H15BrClNO |
| Molecular Weight | 304.62 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | (2R)-2-bromo-N-[2-(4-chlorophenyl)ethyl]butanamide |
| SMILES | CC[C@@H](Br)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15BrClNO/c1-2-11(13)12(16)15-8-7-9-3-5-10(14)6-4-9/h3-6,11H,2,7-8H2,1H3,(H,15,16)/t11-/m1/s1 |
| InChIKey | JNMRCPQSIPYFNI-LLVKDONJSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.62 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|