C12H15F2N3O2 — CID 55093625
2-amino-N-[2-(3,5-difluorophenyl)ethyl]butanediamide (PubChem CID 55093625) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-amino-N-[2-(3,5-difluorophenyl)ethyl]butanediamide.
| Compound Name | 2-amino-N-[2-(3,5-difluorophenyl)ethyl]butanediamide |
|---|---|
| PubChem CID | 55093625 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-amino-N-[2-(3,5-difluorophenyl)ethyl]butanediamide |
| SMILES | NC(=O)CC(N)C(=O)NCCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2N3O2/c13-8-3-7(4-9(14)5-8)1-2-17-12(19)10(15)6-11(16)18/h3-5,10H,1-2,6,15H2,(H2,16,18)(H,17,19) |
| InChIKey | MSLGCSNNEUEWPV-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |